About [dichloro-[(1S,2S)-2-chlorocyclohexyl]-λ4-selanyl]benzene
[dichloro-[(1S,2S)-2-chlorocyclohexyl]-λ4-selanyl]benzene (PubChem CID 86287464) has the molecular formula C12H15Cl3Se
and a molecular weight of 344.57 g/mol. Its IUPAC name is [dichloro-[(1S,2S)-2-chlorocyclohexyl]-λ4-selanyl]benzene.
Molecular Properties
| Compound Name | [dichloro-[(1S,2S)-2-chlorocyclohexyl]-λ4-selanyl]benzene |
| PubChem CID | 86287464 |
| Molecular Formula | C12H15Cl3Se |
| Molecular Weight | 344.57 g/mol |
| Exact Mass | 343.94 |
| IUPAC Name | [dichloro-[(1S,2S)-2-chlorocyclohexyl]-λ4-selanyl]benzene |
| SMILES | Cl[C@H]1CCCC[C@@H]1[Se](Cl)(Cl)c1ccccc1 |
| InChI | InChI=1S/C12H15Cl3Se/c13-11-8-4-5-9-12(11)16(14,15)10-6-2-1-3-7-10/h1-3,6-7,11-12H,4-5,8-9H2/t11-,12-/m0/s1 |
| InChIKey | WUSKQAKILARALY-RYUDHWBXSA-N |
| XLogP | 4.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.57 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [dichloro-[(1S,2S)-2-chlorocyclohexyl]-λ4-selanyl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [dichloro-[(1S,2S)-2-chlorocyclohexyl]-λ4-selanyl]benzene?
The IUPAC name of [dichloro-[(1S,2S)-2-chlorocyclohexyl]-λ4-selanyl]benzene (CID 86287464) is [dichloro-[(1S,2S)-2-chlorocyclohexyl]-λ4-selanyl]benzene.
What is the SMILES notation for [dichloro-[(1S,2S)-2-chlorocyclohexyl]-λ4-selanyl]benzene?
The canonical SMILES for [dichloro-[(1S,2S)-2-chlorocyclohexyl]-λ4-selanyl]benzene is Cl[C@H]1CCCC[C@@H]1[Se](Cl)(Cl)c1ccccc1.
What is the InChIKey of [dichloro-[(1S,2S)-2-chlorocyclohexyl]-λ4-selanyl]benzene?
The InChIKey is WUSKQAKILARALY-RYUDHWBXSA-N. The full InChI is InChI=1S/C12H15Cl3Se/c13-11-8-4-5-9-12(11)16(14,15)10-6-2-1-3-7-10/h1-3,6-7,11-12H,4-5,8-9H2/t11-,12-/m0/s1.
What are the key properties of [dichloro-[(1S,2S)-2-chlorocyclohexyl]-λ4-selanyl]benzene?
[dichloro-[(1S,2S)-2-chlorocyclohexyl]-λ4-selanyl]benzene has a molecular weight of 344.57 g/mol, XLogP of 4.36, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [dichloro-[(1S,2S)-2-chlorocyclohexyl]-λ4-selanyl]benzene is sourced from PubChem (CID 86287464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).