C33H41FO6 — CID 86287548
tripropan-2-yl (2R,3S)-2-(3-fluorophenyl)-6-methyl-3-(3-methylbut-2-enyl)-2H-indene-1,1,3-tricarboxylate (PubChem CID 86287548) has the molecular formula C33H41FO6 and a molecular weight of 552.68 g/mol. Its IUPAC name is tripropan-2-yl (2R,3S)-2-(3-fluorophenyl)-6-methyl-3-(3-methylbut-2-enyl)-2H-indene-1,1,3-tricarboxylate.
| Compound Name | tripropan-2-yl (2R,3S)-2-(3-fluorophenyl)-6-methyl-3-(3-methylbut-2-enyl)-2H-indene-1,1,3-tricarboxylate |
|---|---|
| PubChem CID | 86287548 |
| Molecular Formula | C33H41FO6 |
| Molecular Weight | 552.68 g/mol |
| Exact Mass | 552.29 |
| IUPAC Name | tripropan-2-yl (2R,3S)-2-(3-fluorophenyl)-6-methyl-3-(3-methylbut-2-enyl)-2H-indene-1,1,3-tricarboxylate |
| SMILES | CC(C)=CC[C@@]1(C(=O)OC(C)C)c2ccc(C)cc2C(C(=O)OC(C)C)(C(=O)OC(C)C)[C@@H]1c1cccc(F)c1 |
| InChI | InChI=1S/C33H41FO6/c1-19(2)15-16-32(29(35)38-20(3)4)26-14-13-23(9)17-27(26)33(30(36)39-21(5)6,31(37)40-22(7)8)28(32)24-11-10-12-25(34)18-24/h10-15,17-18,20-22,28H,16H2,1-9H3/t28-,32-/m1/s1 |
| InChIKey | LINCRLSDQNGIPS-AKGWNBJDSA-N |
| XLogP | 6.62 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.68 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|