C26H33N3O7 — CID 86287628
(2S)-2,6-diaminohexanoic acid;(1S,4R,5R,7S)-3,4-dibenzyl-2-oxo-6,8-dioxa-3-azabicyclo[3.2.1]octane-7-carboxylic acid (PubChem CID 86287628) has the molecular formula C26H33N3O7 and a molecular weight of 499.56 g/mol. Its IUPAC name is (2S)-2,6-diaminohexanoic acid;(1S,4R,5R,7S)-3,4-dibenzyl-2-oxo-6,8-dioxa-3-azabicyclo[3.2.1]octane-7-carboxylic acid.
| Compound Name | (2S)-2,6-diaminohexanoic acid;(1S,4R,5R,7S)-3,4-dibenzyl-2-oxo-6,8-dioxa-3-azabicyclo[3.2.1]octane-7-carboxylic acid |
|---|---|
| PubChem CID | 86287628 |
| Molecular Formula | C26H33N3O7 |
| Molecular Weight | 499.56 g/mol |
| Exact Mass | 499.23 |
| IUPAC Name | (2S)-2,6-diaminohexanoic acid;(1S,4R,5R,7S)-3,4-dibenzyl-2-oxo-6,8-dioxa-3-azabicyclo[3.2.1]octane-7-carboxylic acid |
| SMILES | NCCCC[C@H](N)C(=O)O.O=C(O)[C@H]1O[C@H]2O[C@@H]1C(=O)N(Cc1ccccc1)[C@@H]2Cc1ccccc1 |
| InChI | InChI=1S/C20H19NO5.C6H14N2O2/c22-18-16-17(19(23)24)26-20(25-16)15(11-13-7-3-1-4-8-13)21(18)12-14-9-5-2-6-10-14;7-4-2-1-3-5(8)6(9)10/h1-10,15-17,20H,11-12H2,(H,23,24);5H,1-4,7-8H2,(H,9,10)/t15-,16+,17+,20-;5-/m10/s1 |
| InChIKey | YPNKSDGOQZDCHO-CSKBBNCPSA-N |
| XLogP | 1.36 |
| TPSA | 165.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.56 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|