C21H19Cl2FN4O2 — CID 86287734
3-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]-5,6,7,8-tetrahydro-1,6-naphthyridin-8-ol (PubChem CID 86287734) has the molecular formula C21H19Cl2FN4O2 and a molecular weight of 449.31 g/mol. Its IUPAC name is 3-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]-5,6,7,8-tetrahydro-1,6-naphthyridin-8-ol.
| Compound Name | 3-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]-5,6,7,8-tetrahydro-1,6-naphthyridin-8-ol |
|---|---|
| PubChem CID | 86287734 |
| Molecular Formula | C21H19Cl2FN4O2 |
| Molecular Weight | 449.31 g/mol |
| Exact Mass | 448.09 |
| IUPAC Name | 3-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]-5,6,7,8-tetrahydro-1,6-naphthyridin-8-ol |
| SMILES | CC(Oc1cc(-c2cnc3c(c2)CNCC3O)cnc1N)c1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C21H19Cl2FN4O2/c1-10(18-14(22)2-3-15(24)19(18)23)30-17-5-12(8-28-21(17)25)11-4-13-6-26-9-16(29)20(13)27-7-11/h2-5,7-8,10,16,26,29H,6,9H2,1H3,(H2,25,28) |
| InChIKey | DPNBOGPJIILFCB-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 93.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.31 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|