C26H31N3O3 — CID 86288969
N-[(1R,2S)-1-hydroxy-1-phenyl-3-[(6-pyridin-2-yl-2-pyridinyl)methoxy]propan-2-yl]hexanamide (PubChem CID 86288969) has the molecular formula C26H31N3O3 and a molecular weight of 433.55 g/mol. Its IUPAC name is N-[(1R,2S)-1-hydroxy-1-phenyl-3-[(6-pyridin-2-yl-2-pyridinyl)methoxy]propan-2-yl]hexanamide.
| Compound Name | N-[(1R,2S)-1-hydroxy-1-phenyl-3-[(6-pyridin-2-yl-2-pyridinyl)methoxy]propan-2-yl]hexanamide |
|---|---|
| PubChem CID | 86288969 |
| Molecular Formula | C26H31N3O3 |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.24 |
| IUPAC Name | N-[(1R,2S)-1-hydroxy-1-phenyl-3-[(6-pyridin-2-yl-2-pyridinyl)methoxy]propan-2-yl]hexanamide |
| SMILES | CCCCCC(=O)N[C@@H](COCc1cccc(-c2ccccn2)n1)[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C26H31N3O3/c1-2-3-5-16-25(30)29-24(26(31)20-11-6-4-7-12-20)19-32-18-21-13-10-15-23(28-21)22-14-8-9-17-27-22/h4,6-15,17,24,26,31H,2-3,5,16,18-19H2,1H3,(H,29,30)/t24-,26+/m0/s1 |
| InChIKey | OOIDUPZQOKFSOW-AZGAKELHSA-N |
| XLogP | 4.46 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|