C21H27N2O3+ — CID 86289343
[(1R,9R,10S,12R,13S,14R,16S,18R)-13-ethyl-14-hydroxy-8-aza-15-azoniahexacyclo[14.2.1.01,9.02,7.010,15.012,17]nonadeca-2,4,6-trien-18-yl] acetate (PubChem CID 86289343) has the molecular formula C21H27N2O3+ and a molecular weight of 355.46 g/mol. Its IUPAC name is [(1R,9R,10S,12R,13S,14R,16S,18R)-13-ethyl-14-hydroxy-8-aza-15-azoniahexacyclo[14.2.1.01,9.02,7.010,15.012,17]nonadeca-2,4,6-trien-18-yl] acetate.
| Compound Name | [(1R,9R,10S,12R,13S,14R,16S,18R)-13-ethyl-14-hydroxy-8-aza-15-azoniahexacyclo[14.2.1.01,9.02,7.010,15.012,17]nonadeca-2,4,6-trien-18-yl] acetate |
|---|---|
| PubChem CID | 86289343 |
| Molecular Formula | C21H27N2O3+ |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.20 |
| IUPAC Name | [(1R,9R,10S,12R,13S,14R,16S,18R)-13-ethyl-14-hydroxy-8-aza-15-azoniahexacyclo[14.2.1.01,9.02,7.010,15.012,17]nonadeca-2,4,6-trien-18-yl] acetate |
| SMILES | CC[C@H]1[C@@H]2C[C@H]3[C@@H]4Nc5ccccc5[C@]45C[C@@H](C2C5OC(C)=O)[NH+]3[C@@H]1O |
| InChI | InChI=1S/C21H26N2O3/c1-3-11-12-8-15-18-21(13-6-4-5-7-14(13)22-18)9-16(23(15)20(11)25)17(12)19(21)26-10(2)24/h4-7,11-12,15-20,22,25H,3,8-9H2,1-2H3/p+1/t11-,12-,15-,16-,17?,18-,19?,20+,21+/m0/s1 |
| InChIKey | VAOXSMUPPRUEKF-QOFRAONISA-O |
| XLogP | 0.68 |
| TPSA | 63.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |