C12H19O8- — CID 86289408
(2R,4R,5R,6S)-4,5-dihydroxy-6-[(1R)-2-hydroxy-1-methoxyethyl]-2-prop-2-enoxyoxane-2-carboxylate (PubChem CID 86289408) has the molecular formula C12H19O8- and a molecular weight of 291.28 g/mol. Its IUPAC name is (2R,4R,5R,6S)-4,5-dihydroxy-6-[(1R)-2-hydroxy-1-methoxyethyl]-2-prop-2-enoxyoxane-2-carboxylate.
| Compound Name | (2R,4R,5R,6S)-4,5-dihydroxy-6-[(1R)-2-hydroxy-1-methoxyethyl]-2-prop-2-enoxyoxane-2-carboxylate |
|---|---|
| PubChem CID | 86289408 |
| Molecular Formula | C12H19O8- |
| Molecular Weight | 291.28 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | (2R,4R,5R,6S)-4,5-dihydroxy-6-[(1R)-2-hydroxy-1-methoxyethyl]-2-prop-2-enoxyoxane-2-carboxylate |
| SMILES | C=CCO[C@]1(C(=O)[O-])C[C@@H](O)[C@@H](O)[C@@H]([C@@H](CO)OC)O1 |
| InChI | InChI=1S/C12H20O8/c1-3-4-19-12(11(16)17)5-7(14)9(15)10(20-12)8(6-13)18-2/h3,7-10,13-15H,1,4-6H2,2H3,(H,16,17)/p-1/t7-,8-,9-,10-,12-/m1/s1 |
| InChIKey | IMKBELSZGHUWES-SANCVJEGSA-M |
| XLogP | -2.85 |
| TPSA | 128.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.28 |
| LogP ≤ 5 | -2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|