C20H17O8- — CID 86289421
3,6,8-trihydroxy-2-[(1S)-1-hydroxy-5-oxohexyl]-9,10-dioxoanthracen-1-olate (PubChem CID 86289421) has the molecular formula C20H17O8- and a molecular weight of 385.35 g/mol. Its IUPAC name is 3,6,8-trihydroxy-2-[(1S)-1-hydroxy-5-oxohexyl]-9,10-dioxoanthracen-1-olate.
| Compound Name | 3,6,8-trihydroxy-2-[(1S)-1-hydroxy-5-oxohexyl]-9,10-dioxoanthracen-1-olate |
|---|---|
| PubChem CID | 86289421 |
| Molecular Formula | C20H17O8- |
| Molecular Weight | 385.35 g/mol |
| Exact Mass | 385.09 |
| IUPAC Name | 3,6,8-trihydroxy-2-[(1S)-1-hydroxy-5-oxohexyl]-9,10-dioxoanthracen-1-olate |
| SMILES | CC(=O)CCC[C@H](O)c1c(O)cc2c(c1[O-])C(=O)c1c(O)cc(O)cc1C2=O |
| InChI | InChI=1S/C20H18O8/c1-8(21)3-2-4-12(23)17-14(25)7-11-16(20(17)28)19(27)15-10(18(11)26)5-9(22)6-13(15)24/h5-7,12,22-25,28H,2-4H2,1H3/p-1/t12-/m0/s1 |
| InChIKey | JJDSVOQKAOJVOK-LBPRGKRZSA-M |
| XLogP | 1.45 |
| TPSA | 155.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.35 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|