About (E)-10-(3,5-dihydroxy-6-methyloxan-2-yl)oxyundec-2-enoic acid
(E)-10-(3,5-dihydroxy-6-methyloxan-2-yl)oxyundec-2-enoic acid (PubChem CID 86289688) has the molecular formula C17H30O6
and a molecular weight of 330.42 g/mol. Its IUPAC name is (E)-10-(3,5-dihydroxy-6-methyloxan-2-yl)oxyundec-2-enoic acid.
Molecular Properties
| Compound Name | (E)-10-(3,5-dihydroxy-6-methyloxan-2-yl)oxyundec-2-enoic acid |
| PubChem CID | 86289688 |
| Molecular Formula | C17H30O6 |
| Molecular Weight | 330.42 g/mol |
| Exact Mass | 330.20 |
| IUPAC Name | (E)-10-(3,5-dihydroxy-6-methyloxan-2-yl)oxyundec-2-enoic acid |
| SMILES | CC(CCCCCC/C=C/C(=O)O)OC1OC(C)C(O)CC1O |
| InChI | InChI=1S/C17H30O6/c1-12(9-7-5-3-4-6-8-10-16(20)21)22-17-15(19)11-14(18)13(2)23-17/h8,10,12-15,17-19H,3-7,9,11H2,1-2H3,(H,20,21)/b10-8+ |
| InChIKey | NEVPBIQTDNVVMK-CSKARUKUSA-N |
| XLogP | 2.23 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.42 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-10-(3,5-dihydroxy-6-methyloxan-2-yl)oxyundec-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-10-(3,5-dihydroxy-6-methyloxan-2-yl)oxyundec-2-enoic acid?
The IUPAC name of (E)-10-(3,5-dihydroxy-6-methyloxan-2-yl)oxyundec-2-enoic acid (CID 86289688) is (E)-10-(3,5-dihydroxy-6-methyloxan-2-yl)oxyundec-2-enoic acid.
What is the SMILES notation for (E)-10-(3,5-dihydroxy-6-methyloxan-2-yl)oxyundec-2-enoic acid?
The canonical SMILES for (E)-10-(3,5-dihydroxy-6-methyloxan-2-yl)oxyundec-2-enoic acid is CC(CCCCCC/C=C/C(=O)O)OC1OC(C)C(O)CC1O.
What is the InChIKey of (E)-10-(3,5-dihydroxy-6-methyloxan-2-yl)oxyundec-2-enoic acid?
The InChIKey is NEVPBIQTDNVVMK-CSKARUKUSA-N. The full InChI is InChI=1S/C17H30O6/c1-12(9-7-5-3-4-6-8-10-16(20)21)22-17-15(19)11-14(18)13(2)23-17/h8,10,12-15,17-19H,3-7,9,11H2,1-2H3,(H,20,21)/b10-8+.
What are the key properties of (E)-10-(3,5-dihydroxy-6-methyloxan-2-yl)oxyundec-2-enoic acid?
(E)-10-(3,5-dihydroxy-6-methyloxan-2-yl)oxyundec-2-enoic acid has a molecular weight of 330.42 g/mol, XLogP of 2.23, 10 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-10-(3,5-dihydroxy-6-methyloxan-2-yl)oxyundec-2-enoic acid is sourced from PubChem (CID 86289688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).