About (3S)-3-acetyloctanal
(3S)-3-acetyloctanal (PubChem CID 86289943) has the molecular formula C10H18O2
and a molecular weight of 170.25 g/mol. Its IUPAC name is (3S)-3-acetyloctanal.
Molecular Properties
| Compound Name | (3S)-3-acetyloctanal |
| PubChem CID | 86289943 |
| Molecular Formula | C10H18O2 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.13 |
| IUPAC Name | (3S)-3-acetyloctanal |
| SMILES | CCCCC[C@@H](CC=O)C(C)=O |
| InChI | InChI=1S/C10H18O2/c1-3-4-5-6-10(7-8-11)9(2)12/h8,10H,3-7H2,1-2H3/t10-/m0/s1 |
| InChIKey | BMGJNRYEOPZWHH-JTQLQIEISA-N |
| XLogP | 2.36 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (3S)-3-acetyloctanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-acetyloctanal?
The IUPAC name of (3S)-3-acetyloctanal (CID 86289943) is (3S)-3-acetyloctanal.
What is the SMILES notation for (3S)-3-acetyloctanal?
The canonical SMILES for (3S)-3-acetyloctanal is CCCCC[C@@H](CC=O)C(C)=O.
What is the InChIKey of (3S)-3-acetyloctanal?
The InChIKey is BMGJNRYEOPZWHH-JTQLQIEISA-N. The full InChI is InChI=1S/C10H18O2/c1-3-4-5-6-10(7-8-11)9(2)12/h8,10H,3-7H2,1-2H3/t10-/m0/s1.
What are the key properties of (3S)-3-acetyloctanal?
(3S)-3-acetyloctanal has a molecular weight of 170.25 g/mol, XLogP of 2.36, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-acetyloctanal is sourced from PubChem (CID 86289943), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).