C29H32FN5O3S — CID 86290321
N-[3-(diethylamino)propyl]-7-[4-[(2-fluoro-5-methylphenyl)carbamoylamino]phenoxy]thieno[3,2-b]pyridine-2-carboxamide (PubChem CID 86290321) has the molecular formula C29H32FN5O3S and a molecular weight of 549.67 g/mol. Its IUPAC name is N-[3-(diethylamino)propyl]-7-[4-[(2-fluoro-5-methylphenyl)carbamoylamino]phenoxy]thieno[3,2-b]pyridine-2-carboxamide.
| Compound Name | N-[3-(diethylamino)propyl]-7-[4-[(2-fluoro-5-methylphenyl)carbamoylamino]phenoxy]thieno[3,2-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 86290321 |
| Molecular Formula | C29H32FN5O3S |
| Molecular Weight | 549.67 g/mol |
| Exact Mass | 549.22 |
| IUPAC Name | N-[3-(diethylamino)propyl]-7-[4-[(2-fluoro-5-methylphenyl)carbamoylamino]phenoxy]thieno[3,2-b]pyridine-2-carboxamide |
| SMILES | CCN(CC)CCCNC(=O)c1cc2nccc(Oc3ccc(NC(=O)Nc4cc(C)ccc4F)cc3)c2s1 |
| InChI | InChI=1S/C29H32FN5O3S/c1-4-35(5-2)16-6-14-32-28(36)26-18-24-27(39-26)25(13-15-31-24)38-21-10-8-20(9-11-21)33-29(37)34-23-17-19(3)7-12-22(23)30/h7-13,15,17-18H,4-6,14,16H2,1-3H3,(H,32,36)(H2,33,34,37) |
| InChIKey | TYSQFVMRVYDAEQ-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 95.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.67 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|