C23H21N3O5S — CID 86290368
N-(3-hydroxypropyl)-7-[3-[(3-methylfuran-2-carbonyl)amino]phenoxy]thieno[3,2-b]pyridine-2-carboxamide (PubChem CID 86290368) has the molecular formula C23H21N3O5S and a molecular weight of 451.50 g/mol. Its IUPAC name is N-(3-hydroxypropyl)-7-[3-[(3-methylfuran-2-carbonyl)amino]phenoxy]thieno[3,2-b]pyridine-2-carboxamide.
| Compound Name | N-(3-hydroxypropyl)-7-[3-[(3-methylfuran-2-carbonyl)amino]phenoxy]thieno[3,2-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 86290368 |
| Molecular Formula | C23H21N3O5S |
| Molecular Weight | 451.50 g/mol |
| Exact Mass | 451.12 |
| IUPAC Name | N-(3-hydroxypropyl)-7-[3-[(3-methylfuran-2-carbonyl)amino]phenoxy]thieno[3,2-b]pyridine-2-carboxamide |
| SMILES | Cc1ccoc1C(=O)Nc1cccc(Oc2ccnc3cc(C(=O)NCCCO)sc23)c1 |
| InChI | InChI=1S/C23H21N3O5S/c1-14-7-11-30-20(14)23(29)26-15-4-2-5-16(12-15)31-18-6-9-24-17-13-19(32-21(17)18)22(28)25-8-3-10-27/h2,4-7,9,11-13,27H,3,8,10H2,1H3,(H,25,28)(H,26,29) |
| InChIKey | XAQMEOPJZXSVTD-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 113.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.50 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|