C19H25ClN4O2 — CID 86290824
N-(5-chloro-3-cyclobutylimidazo[4,5-b]pyridin-2-yl)-2-[(2R)-6,6-dimethyloxan-2-yl]acetamide (PubChem CID 86290824) has the molecular formula C19H25ClN4O2 and a molecular weight of 376.89 g/mol. Its IUPAC name is N-(5-chloro-3-cyclobutylimidazo[4,5-b]pyridin-2-yl)-2-[(2R)-6,6-dimethyloxan-2-yl]acetamide.
| Compound Name | N-(5-chloro-3-cyclobutylimidazo[4,5-b]pyridin-2-yl)-2-[(2R)-6,6-dimethyloxan-2-yl]acetamide |
|---|---|
| PubChem CID | 86290824 |
| Molecular Formula | C19H25ClN4O2 |
| Molecular Weight | 376.89 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | N-(5-chloro-3-cyclobutylimidazo[4,5-b]pyridin-2-yl)-2-[(2R)-6,6-dimethyloxan-2-yl]acetamide |
| SMILES | CC1(C)CCC[C@H](CC(=O)Nc2nc3ccc(Cl)nc3n2C2CCC2)O1 |
| InChI | InChI=1S/C19H25ClN4O2/c1-19(2)10-4-7-13(26-19)11-16(25)23-18-21-14-8-9-15(20)22-17(14)24(18)12-5-3-6-12/h8-9,12-13H,3-7,10-11H2,1-2H3,(H,21,23,25)/t13-/m1/s1 |
| InChIKey | HOIKZAXHKLMAJZ-CYBMUJFWSA-N |
| XLogP | 4.49 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.89 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|