C14H25N3O9 — CID 86290837
3-[[(1R,3S,4S,6R)-3-(2-carboxyethylamino)-5-(carboxymethylamino)-2,4,6-trihydroxycyclohexyl]amino]propanoic acid (PubChem CID 86290837) has the molecular formula C14H25N3O9 and a molecular weight of 379.37 g/mol. Its IUPAC name is 3-[[(1R,3S,4S,6R)-3-(2-carboxyethylamino)-5-(carboxymethylamino)-2,4,6-trihydroxycyclohexyl]amino]propanoic acid.
| Compound Name | 3-[[(1R,3S,4S,6R)-3-(2-carboxyethylamino)-5-(carboxymethylamino)-2,4,6-trihydroxycyclohexyl]amino]propanoic acid |
|---|---|
| PubChem CID | 86290837 |
| Molecular Formula | C14H25N3O9 |
| Molecular Weight | 379.37 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | 3-[[(1R,3S,4S,6R)-3-(2-carboxyethylamino)-5-(carboxymethylamino)-2,4,6-trihydroxycyclohexyl]amino]propanoic acid |
| SMILES | O=C(O)CCN[C@@H]1C(O)[C@H](NCCC(=O)O)[C@H](O)C(NCC(=O)O)[C@@H]1O |
| InChI | InChI=1S/C14H25N3O9/c18-6(19)1-3-15-9-12(24)10(16-4-2-7(20)21)14(26)11(13(9)25)17-5-8(22)23/h9-17,24-26H,1-5H2,(H,18,19)(H,20,21)(H,22,23)/t9-,10+,11?,12?,13-,14+ |
| InChIKey | WAOJMVRWFLHHNS-LHQMGJFGSA-N |
| XLogP | -4.01 |
| TPSA | 208.68 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.37 |
| LogP ≤ 5 | -4.01 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |