About 2-[2-chloro-4-(2,4-difluorophenyl)-6-methoxyphenyl]-4-prop-2-ynylcyclopentane-1,3-dione
2-[2-chloro-4-(2,4-difluorophenyl)-6-methoxyphenyl]-4-prop-2-ynylcyclopentane-1,3-dione (PubChem CID 86291482) has the molecular formula C21H15ClF2O3
and a molecular weight of 388.80 g/mol. Its IUPAC name is 2-[2-chloro-4-(2,4-difluorophenyl)-6-methoxyphenyl]-4-prop-2-ynylcyclopentane-1,3-dione.
Molecular Properties
| Compound Name | 2-[2-chloro-4-(2,4-difluorophenyl)-6-methoxyphenyl]-4-prop-2-ynylcyclopentane-1,3-dione |
| PubChem CID | 86291482 |
| Molecular Formula | C21H15ClF2O3 |
| Molecular Weight | 388.80 g/mol |
| Exact Mass | 388.07 |
| IUPAC Name | 2-[2-chloro-4-(2,4-difluorophenyl)-6-methoxyphenyl]-4-prop-2-ynylcyclopentane-1,3-dione |
| SMILES | C#CCC1CC(=O)C(c2c(Cl)cc(-c3ccc(F)cc3F)cc2OC)C1=O |
| InChI | InChI=1S/C21H15ClF2O3/c1-3-4-11-8-17(25)20(21(11)26)19-15(22)7-12(9-18(19)27-2)14-6-5-13(23)10-16(14)24/h1,5-7,9-11,20H,4,8H2,2H3 |
| InChIKey | JUDLFBPTDXSXNJ-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.80 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-chloro-4-(2,4-difluorophenyl)-6-methoxyphenyl]-4-prop-2-ynylcyclopentane-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-chloro-4-(2,4-difluorophenyl)-6-methoxyphenyl]-4-prop-2-ynylcyclopentane-1,3-dione?
The IUPAC name of 2-[2-chloro-4-(2,4-difluorophenyl)-6-methoxyphenyl]-4-prop-2-ynylcyclopentane-1,3-dione (CID 86291482) is 2-[2-chloro-4-(2,4-difluorophenyl)-6-methoxyphenyl]-4-prop-2-ynylcyclopentane-1,3-dione.
What is the SMILES notation for 2-[2-chloro-4-(2,4-difluorophenyl)-6-methoxyphenyl]-4-prop-2-ynylcyclopentane-1,3-dione?
The canonical SMILES for 2-[2-chloro-4-(2,4-difluorophenyl)-6-methoxyphenyl]-4-prop-2-ynylcyclopentane-1,3-dione is C#CCC1CC(=O)C(c2c(Cl)cc(-c3ccc(F)cc3F)cc2OC)C1=O.
What is the InChIKey of 2-[2-chloro-4-(2,4-difluorophenyl)-6-methoxyphenyl]-4-prop-2-ynylcyclopentane-1,3-dione?
The InChIKey is JUDLFBPTDXSXNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H15ClF2O3/c1-3-4-11-8-17(25)20(21(11)26)19-15(22)7-12(9-18(19)27-2)14-6-5-13(23)10-16(14)24/h1,5-7,9-11,20H,4,8H2,2H3.
What are the key properties of 2-[2-chloro-4-(2,4-difluorophenyl)-6-methoxyphenyl]-4-prop-2-ynylcyclopentane-1,3-dione?
2-[2-chloro-4-(2,4-difluorophenyl)-6-methoxyphenyl]-4-prop-2-ynylcyclopentane-1,3-dione has a molecular weight of 388.80 g/mol, XLogP of 4.56, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-chloro-4-(2,4-difluorophenyl)-6-methoxyphenyl]-4-prop-2-ynylcyclopentane-1,3-dione is sourced from PubChem (CID 86291482), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).