C16H14N2O3S — CID 86291612
1-[6-(cyanomethoxy)quinolin-4-yl]sulfanylcyclobutane-1-carboxylic acid (PubChem CID 86291612) has the molecular formula C16H14N2O3S and a molecular weight of 314.37 g/mol. Its IUPAC name is 1-[6-(cyanomethoxy)quinolin-4-yl]sulfanylcyclobutane-1-carboxylic acid.
| Compound Name | 1-[6-(cyanomethoxy)quinolin-4-yl]sulfanylcyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 86291612 |
| Molecular Formula | C16H14N2O3S |
| Molecular Weight | 314.37 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | 1-[6-(cyanomethoxy)quinolin-4-yl]sulfanylcyclobutane-1-carboxylic acid |
| SMILES | N#CCOc1ccc2nccc(SC3(C(=O)O)CCC3)c2c1 |
| InChI | InChI=1S/C16H14N2O3S/c17-7-9-21-11-2-3-13-12(10-11)14(4-8-18-13)22-16(15(19)20)5-1-6-16/h2-4,8,10H,1,5-6,9H2,(H,19,20) |
| InChIKey | IPCHXGYIYQCWKM-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 83.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.37 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |