C25H28F2N4O3 — CID 86291746
4-amino-6-(3-cyclohexylpropyl)-N-[(2,4-difluorophenyl)methyl]-1-hydroxy-2-oxo-1,8-naphthyridine-3-carboxamide (PubChem CID 86291746) has the molecular formula C25H28F2N4O3 and a molecular weight of 470.52 g/mol. Its IUPAC name is 4-amino-6-(3-cyclohexylpropyl)-N-[(2,4-difluorophenyl)methyl]-1-hydroxy-2-oxo-1,8-naphthyridine-3-carboxamide.
| Compound Name | 4-amino-6-(3-cyclohexylpropyl)-N-[(2,4-difluorophenyl)methyl]-1-hydroxy-2-oxo-1,8-naphthyridine-3-carboxamide |
|---|---|
| PubChem CID | 86291746 |
| Molecular Formula | C25H28F2N4O3 |
| Molecular Weight | 470.52 g/mol |
| Exact Mass | 470.21 |
| IUPAC Name | 4-amino-6-(3-cyclohexylpropyl)-N-[(2,4-difluorophenyl)methyl]-1-hydroxy-2-oxo-1,8-naphthyridine-3-carboxamide |
| SMILES | Nc1c(C(=O)NCc2ccc(F)cc2F)c(=O)n(O)c2ncc(CCCC3CCCCC3)cc12 |
| InChI | InChI=1S/C25H28F2N4O3/c26-18-10-9-17(20(27)12-18)14-30-24(32)21-22(28)19-11-16(13-29-23(19)31(34)25(21)33)8-4-7-15-5-2-1-3-6-15/h9-13,15,34H,1-8,14,28H2,(H,30,32) |
| InChIKey | OQDSQTTWIJZOEH-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.52 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|