C26H24F2N4O3 — CID 86291747
4-amino-N-[(2,4-difluorophenyl)methyl]-1-hydroxy-2-oxo-6-(4-phenylbutyl)-1,8-naphthyridine-3-carboxamide (PubChem CID 86291747) has the molecular formula C26H24F2N4O3 and a molecular weight of 478.50 g/mol. Its IUPAC name is 4-amino-N-[(2,4-difluorophenyl)methyl]-1-hydroxy-2-oxo-6-(4-phenylbutyl)-1,8-naphthyridine-3-carboxamide.
| Compound Name | 4-amino-N-[(2,4-difluorophenyl)methyl]-1-hydroxy-2-oxo-6-(4-phenylbutyl)-1,8-naphthyridine-3-carboxamide |
|---|---|
| PubChem CID | 86291747 |
| Molecular Formula | C26H24F2N4O3 |
| Molecular Weight | 478.50 g/mol |
| Exact Mass | 478.18 |
| IUPAC Name | 4-amino-N-[(2,4-difluorophenyl)methyl]-1-hydroxy-2-oxo-6-(4-phenylbutyl)-1,8-naphthyridine-3-carboxamide |
| SMILES | Nc1c(C(=O)NCc2ccc(F)cc2F)c(=O)n(O)c2ncc(CCCCc3ccccc3)cc12 |
| InChI | InChI=1S/C26H24F2N4O3/c27-19-11-10-18(21(28)13-19)15-31-25(33)22-23(29)20-12-17(14-30-24(20)32(35)26(22)34)9-5-4-8-16-6-2-1-3-7-16/h1-3,6-7,10-14,35H,4-5,8-9,15,29H2,(H,31,33) |
| InChIKey | WGPQZNMRNJBJGE-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.50 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|