C20H13FN4O5S — CID 86291972
3-cyano-4-(2-cyanophenoxy)-N-(5-fluoro-2-pyridinyl)benzenesulfonamide;formic acid (PubChem CID 86291972) has the molecular formula C20H13FN4O5S and a molecular weight of 440.41 g/mol. Its IUPAC name is 3-cyano-4-(2-cyanophenoxy)-N-(5-fluoro-2-pyridinyl)benzenesulfonamide;formic acid.
| Compound Name | 3-cyano-4-(2-cyanophenoxy)-N-(5-fluoro-2-pyridinyl)benzenesulfonamide;formic acid |
|---|---|
| PubChem CID | 86291972 |
| Molecular Formula | C20H13FN4O5S |
| Molecular Weight | 440.41 g/mol |
| Exact Mass | 440.06 |
| IUPAC Name | 3-cyano-4-(2-cyanophenoxy)-N-(5-fluoro-2-pyridinyl)benzenesulfonamide;formic acid |
| SMILES | N#Cc1ccccc1Oc1ccc(S(=O)(=O)Nc2ccc(F)cn2)cc1C#N.O=CO |
| InChI | InChI=1S/C19H11FN4O3S.CH2O2/c20-15-5-8-19(23-12-15)24-28(25,26)16-6-7-18(14(9-16)11-22)27-17-4-2-1-3-13(17)10-21;2-1-3/h1-9,12H,(H,23,24);1H,(H,2,3) |
| InChIKey | ORWTXFYOPVNNII-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 153.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.41 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|