C26H34N4O2 — CID 86292233
(13E)-17-[ethyl(piperidin-4-yl)amino]-8-methyl-3,7-diazatricyclo[14.4.0.05,10]icosa-1(16),5(10),8,13,17,19-hexaene-2,6-dione (PubChem CID 86292233) has the molecular formula C26H34N4O2 and a molecular weight of 434.58 g/mol. Its IUPAC name is (13E)-17-[ethyl(piperidin-4-yl)amino]-8-methyl-3,7-diazatricyclo[14.4.0.05,10]icosa-1(16),5(10),8,13,17,19-hexaene-2,6-dione.
| Compound Name | (13E)-17-[ethyl(piperidin-4-yl)amino]-8-methyl-3,7-diazatricyclo[14.4.0.05,10]icosa-1(16),5(10),8,13,17,19-hexaene-2,6-dione |
|---|---|
| PubChem CID | 86292233 |
| Molecular Formula | C26H34N4O2 |
| Molecular Weight | 434.58 g/mol |
| Exact Mass | 434.27 |
| IUPAC Name | (13E)-17-[ethyl(piperidin-4-yl)amino]-8-methyl-3,7-diazatricyclo[14.4.0.05,10]icosa-1(16),5(10),8,13,17,19-hexaene-2,6-dione |
| SMILES | CCN(c1cccc2c1C/C=C/CCc1cc(C)[nH]c(=O)c1CNC2=O)C1CCNCC1 |
| InChI | InChI=1S/C26H34N4O2/c1-3-30(20-12-14-27-15-13-20)24-11-7-10-22-21(24)9-6-4-5-8-19-16-18(2)29-26(32)23(19)17-28-25(22)31/h4,6-7,10-11,16,20,27H,3,5,8-9,12-15,17H2,1-2H3,(H,28,31)(H,29,32)/b6-4+ |
| InChIKey | OKUFKPFKQQFJJN-GQCTYLIASA-N |
| XLogP | 3.24 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.58 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|