C27H31N5 — CID 86292430
6-[2-(1-methylpiperidin-4-yl)-1H-pyrrolo[2,3-b]pyridin-4-yl]-N-(3-phenylpropyl)pyridin-2-amine (PubChem CID 86292430) has the molecular formula C27H31N5 and a molecular weight of 425.58 g/mol. Its IUPAC name is 6-[2-(1-methylpiperidin-4-yl)-1H-pyrrolo[2,3-b]pyridin-4-yl]-N-(3-phenylpropyl)pyridin-2-amine.
| Compound Name | 6-[2-(1-methylpiperidin-4-yl)-1H-pyrrolo[2,3-b]pyridin-4-yl]-N-(3-phenylpropyl)pyridin-2-amine |
|---|---|
| PubChem CID | 86292430 |
| Molecular Formula | C27H31N5 |
| Molecular Weight | 425.58 g/mol |
| Exact Mass | 425.26 |
| IUPAC Name | 6-[2-(1-methylpiperidin-4-yl)-1H-pyrrolo[2,3-b]pyridin-4-yl]-N-(3-phenylpropyl)pyridin-2-amine |
| SMILES | CN1CCC(c2cc3c(-c4cccc(NCCCc5ccccc5)n4)ccnc3[nH]2)CC1 |
| InChI | InChI=1S/C27H31N5/c1-32-17-13-21(14-18-32)25-19-23-22(12-16-29-27(23)31-25)24-10-5-11-26(30-24)28-15-6-9-20-7-3-2-4-8-20/h2-5,7-8,10-12,16,19,21H,6,9,13-15,17-18H2,1H3,(H,28,30)(H,29,31) |
| InChIKey | GQNURJDUNFQWGU-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.58 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|