About 1,1,3-trimethyl-3-(N'-methylcarbamimidoyl)guanidine
1,1,3-trimethyl-3-(N'-methylcarbamimidoyl)guanidine (PubChem CID 86292533) has the molecular formula C6H15N5
and a molecular weight of 157.22 g/mol. Its IUPAC name is 1,1,3-trimethyl-3-(N'-methylcarbamimidoyl)guanidine.
Molecular Properties
| Compound Name | 1,1,3-trimethyl-3-(N'-methylcarbamimidoyl)guanidine |
| PubChem CID | 86292533 |
| Molecular Formula | C6H15N5 |
| Molecular Weight | 157.22 g/mol |
| Exact Mass | 157.13 |
| IUPAC Name | 1,1,3-trimethyl-3-(N'-methylcarbamimidoyl)guanidine |
| SMILES | [H]/N=C(\N(C)C)N(C)/C(N)=N/C |
| InChI | InChI=1S/C6H15N5/c1-9-5(7)11(4)6(8)10(2)3/h8H,1-4H3,(H2,7,9)/b8-6+ |
| InChIKey | RQYHBPZUBLRACU-SOFGYWHQSA-N |
| XLogP | -0.64 |
| TPSA | 68.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.22 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1,1,3-trimethyl-3-(N'-methylcarbamimidoyl)guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1,3-trimethyl-3-(N'-methylcarbamimidoyl)guanidine?
The IUPAC name of 1,1,3-trimethyl-3-(N'-methylcarbamimidoyl)guanidine (CID 86292533) is 1,1,3-trimethyl-3-(N'-methylcarbamimidoyl)guanidine.
What is the SMILES notation for 1,1,3-trimethyl-3-(N'-methylcarbamimidoyl)guanidine?
The canonical SMILES for 1,1,3-trimethyl-3-(N'-methylcarbamimidoyl)guanidine is [H]/N=C(\N(C)C)N(C)/C(N)=N/C.
What is the InChIKey of 1,1,3-trimethyl-3-(N'-methylcarbamimidoyl)guanidine?
The InChIKey is RQYHBPZUBLRACU-SOFGYWHQSA-N. The full InChI is InChI=1S/C6H15N5/c1-9-5(7)11(4)6(8)10(2)3/h8H,1-4H3,(H2,7,9)/b8-6+.
What are the key properties of 1,1,3-trimethyl-3-(N'-methylcarbamimidoyl)guanidine?
1,1,3-trimethyl-3-(N'-methylcarbamimidoyl)guanidine has a molecular weight of 157.22 g/mol, XLogP of -0.64, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1,3-trimethyl-3-(N'-methylcarbamimidoyl)guanidine is sourced from PubChem (CID 86292533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).