C21H18F3N5O — CID 86292960
3-[2-[4-amino-7-(2,2,2-trifluoroethyl)pyrrolo[2,3-d]pyrimidin-5-yl]ethynyl]-N-cyclopropyl-4-methylbenzamide (PubChem CID 86292960) has the molecular formula C21H18F3N5O and a molecular weight of 413.40 g/mol. Its IUPAC name is 3-[2-[4-amino-7-(2,2,2-trifluoroethyl)pyrrolo[2,3-d]pyrimidin-5-yl]ethynyl]-N-cyclopropyl-4-methylbenzamide.
| Compound Name | 3-[2-[4-amino-7-(2,2,2-trifluoroethyl)pyrrolo[2,3-d]pyrimidin-5-yl]ethynyl]-N-cyclopropyl-4-methylbenzamide |
|---|---|
| PubChem CID | 86292960 |
| Molecular Formula | C21H18F3N5O |
| Molecular Weight | 413.40 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | 3-[2-[4-amino-7-(2,2,2-trifluoroethyl)pyrrolo[2,3-d]pyrimidin-5-yl]ethynyl]-N-cyclopropyl-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)NC2CC2)cc1C#Cc1cn(CC(F)(F)F)c2ncnc(N)c12 |
| InChI | InChI=1S/C21H18F3N5O/c1-12-2-3-14(20(30)28-16-6-7-16)8-13(12)4-5-15-9-29(10-21(22,23)24)19-17(15)18(25)26-11-27-19/h2-3,8-9,11,16H,6-7,10H2,1H3,(H,28,30)(H2,25,26,27) |
| InChIKey | RITMDFIGFNSMDQ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.40 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|