C23H20F3N5O — CID 86293380
(9R)-N-pyridin-4-yl-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-8-carboxamide (PubChem CID 86293380) has the molecular formula C23H20F3N5O and a molecular weight of 439.44 g/mol. Its IUPAC name is (9R)-N-pyridin-4-yl-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-8-carboxamide.
| Compound Name | (9R)-N-pyridin-4-yl-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-8-carboxamide |
|---|---|
| PubChem CID | 86293380 |
| Molecular Formula | C23H20F3N5O |
| Molecular Weight | 439.44 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | (9R)-N-pyridin-4-yl-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-8-carboxamide |
| SMILES | O=C(Nc1ccncc1)N1c2nc(-c3cccc(C(F)(F)F)c3)ccc2N2CCC[C@@H]1C2 |
| InChI | InChI=1S/C23H20F3N5O/c24-23(25,26)16-4-1-3-15(13-16)19-6-7-20-21(29-19)31(18-5-2-12-30(20)14-18)22(32)28-17-8-10-27-11-9-17/h1,3-4,6-11,13,18H,2,5,12,14H2,(H,27,28,32)/t18-/m1/s1 |
| InChIKey | CGKSHIJUQHAKSW-GOSISDBHSA-N |
| XLogP | 5.18 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.44 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |