C23H19F4N5O — CID 86293383
(9S)-N-(5-fluoro-3-pyridinyl)-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-8-carboxamide (PubChem CID 86293383) has the molecular formula C23H19F4N5O and a molecular weight of 457.43 g/mol. Its IUPAC name is (9S)-N-(5-fluoro-3-pyridinyl)-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-8-carboxamide.
| Compound Name | (9S)-N-(5-fluoro-3-pyridinyl)-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-8-carboxamide |
|---|---|
| PubChem CID | 86293383 |
| Molecular Formula | C23H19F4N5O |
| Molecular Weight | 457.43 g/mol |
| Exact Mass | 457.15 |
| IUPAC Name | (9S)-N-(5-fluoro-3-pyridinyl)-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-8-carboxamide |
| SMILES | O=C(Nc1cncc(F)c1)N1c2nc(-c3cccc(C(F)(F)F)c3)ccc2N2CCC[C@H]1C2 |
| InChI | InChI=1S/C23H19F4N5O/c24-16-10-17(12-28-11-16)29-22(33)32-18-5-2-8-31(13-18)20-7-6-19(30-21(20)32)14-3-1-4-15(9-14)23(25,26)27/h1,3-4,6-7,9-12,18H,2,5,8,13H2,(H,29,33)/t18-/m0/s1 |
| InChIKey | XKUPFTNKJGNRPF-SFHVURJKSA-N |
| XLogP | 5.32 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.43 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |