C32H37ClN6O2 — CID 86293469
N-[4-[2-[6-(2-chlorophenyl)-2-[4-(diethylamino)butylamino]-7-oxopyrido[2,3-d]pyrimidin-8-yl]ethyl]phenyl]prop-2-enamide (PubChem CID 86293469) has the molecular formula C32H37ClN6O2 and a molecular weight of 573.14 g/mol. Its IUPAC name is N-[4-[2-[6-(2-chlorophenyl)-2-[4-(diethylamino)butylamino]-7-oxopyrido[2,3-d]pyrimidin-8-yl]ethyl]phenyl]prop-2-enamide.
| Compound Name | N-[4-[2-[6-(2-chlorophenyl)-2-[4-(diethylamino)butylamino]-7-oxopyrido[2,3-d]pyrimidin-8-yl]ethyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 86293469 |
| Molecular Formula | C32H37ClN6O2 |
| Molecular Weight | 573.14 g/mol |
| Exact Mass | 572.27 |
| IUPAC Name | N-[4-[2-[6-(2-chlorophenyl)-2-[4-(diethylamino)butylamino]-7-oxopyrido[2,3-d]pyrimidin-8-yl]ethyl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccc(CCn2c(=O)c(-c3ccccc3Cl)cc3cnc(NCCCCN(CC)CC)nc32)cc1 |
| InChI | InChI=1S/C32H37ClN6O2/c1-4-29(40)36-25-15-13-23(14-16-25)17-20-39-30-24(21-27(31(39)41)26-11-7-8-12-28(26)33)22-35-32(37-30)34-18-9-10-19-38(5-2)6-3/h4,7-8,11-16,21-22H,1,5-6,9-10,17-20H2,2-3H3,(H,36,40)(H,34,35,37) |
| InChIKey | HTCPNTMZIFPYSY-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 92.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.14 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|