C23H24ClN3O3S — CID 86293481
1'-[[5-chloro-1-(4-methylsulfonylbutyl)indol-2-yl]methyl]spiro[cyclopropane-1,3'-pyrrolo[2,3-c]pyridine]-2'-one (PubChem CID 86293481) has the molecular formula C23H24ClN3O3S and a molecular weight of 457.98 g/mol. Its IUPAC name is 1'-[[5-chloro-1-(4-methylsulfonylbutyl)indol-2-yl]methyl]spiro[cyclopropane-1,3'-pyrrolo[2,3-c]pyridine]-2'-one.
| Compound Name | 1'-[[5-chloro-1-(4-methylsulfonylbutyl)indol-2-yl]methyl]spiro[cyclopropane-1,3'-pyrrolo[2,3-c]pyridine]-2'-one |
|---|---|
| PubChem CID | 86293481 |
| Molecular Formula | C23H24ClN3O3S |
| Molecular Weight | 457.98 g/mol |
| Exact Mass | 457.12 |
| IUPAC Name | 1'-[[5-chloro-1-(4-methylsulfonylbutyl)indol-2-yl]methyl]spiro[cyclopropane-1,3'-pyrrolo[2,3-c]pyridine]-2'-one |
| SMILES | CS(=O)(=O)CCCCn1c(CN2C(=O)C3(CC3)c3ccncc32)cc2cc(Cl)ccc21 |
| InChI | InChI=1S/C23H24ClN3O3S/c1-31(29,30)11-3-2-10-26-18(13-16-12-17(24)4-5-20(16)26)15-27-21-14-25-9-6-19(21)23(7-8-23)22(27)28/h4-6,9,12-14H,2-3,7-8,10-11,15H2,1H3 |
| InChIKey | KWYRFVRBRHFZAU-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 72.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.98 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|