About 2-[2,2-bis(4,4-difluorocyclohexyl)ethyl]piperidine
2-[2,2-bis(4,4-difluorocyclohexyl)ethyl]piperidine (PubChem CID 86293528) has the molecular formula C19H31F4N
and a molecular weight of 349.46 g/mol. Its IUPAC name is 2-[2,2-bis(4,4-difluorocyclohexyl)ethyl]piperidine.
Molecular Properties
| Compound Name | 2-[2,2-bis(4,4-difluorocyclohexyl)ethyl]piperidine |
| PubChem CID | 86293528 |
| Molecular Formula | C19H31F4N |
| Molecular Weight | 349.46 g/mol |
| Exact Mass | 349.24 |
| IUPAC Name | 2-[2,2-bis(4,4-difluorocyclohexyl)ethyl]piperidine |
| SMILES | FC1(F)CCC(C(CC2CCCCN2)C2CCC(F)(F)CC2)CC1 |
| InChI | InChI=1S/C19H31F4N/c20-18(21)8-4-14(5-9-18)17(13-16-3-1-2-12-24-16)15-6-10-19(22,23)11-7-15/h14-17,24H,1-13H2 |
| InChIKey | ODZQWWGZCHXVIV-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 349.46 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-[2,2-bis(4,4-difluorocyclohexyl)ethyl]piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2,2-bis(4,4-difluorocyclohexyl)ethyl]piperidine?
The IUPAC name of 2-[2,2-bis(4,4-difluorocyclohexyl)ethyl]piperidine (CID 86293528) is 2-[2,2-bis(4,4-difluorocyclohexyl)ethyl]piperidine.
What is the SMILES notation for 2-[2,2-bis(4,4-difluorocyclohexyl)ethyl]piperidine?
The canonical SMILES for 2-[2,2-bis(4,4-difluorocyclohexyl)ethyl]piperidine is FC1(F)CCC(C(CC2CCCCN2)C2CCC(F)(F)CC2)CC1.
What is the InChIKey of 2-[2,2-bis(4,4-difluorocyclohexyl)ethyl]piperidine?
The InChIKey is ODZQWWGZCHXVIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H31F4N/c20-18(21)8-4-14(5-9-18)17(13-16-3-1-2-12-24-16)15-6-10-19(22,23)11-7-15/h14-17,24H,1-13H2.
What are the key properties of 2-[2,2-bis(4,4-difluorocyclohexyl)ethyl]piperidine?
2-[2,2-bis(4,4-difluorocyclohexyl)ethyl]piperidine has a molecular weight of 349.46 g/mol, XLogP of 5.79, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2,2-bis(4,4-difluorocyclohexyl)ethyl]piperidine is sourced from PubChem (CID 86293528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).