C28H20F2N4O3 — CID 86294241
N-[(2,4-difluorophenyl)methyl]-1-hydroxy-2-oxo-4-(4-phenylanilino)-1,8-naphthyridine-3-carboxamide (PubChem CID 86294241) has the molecular formula C28H20F2N4O3 and a molecular weight of 498.49 g/mol. Its IUPAC name is N-[(2,4-difluorophenyl)methyl]-1-hydroxy-2-oxo-4-(4-phenylanilino)-1,8-naphthyridine-3-carboxamide.
| Compound Name | N-[(2,4-difluorophenyl)methyl]-1-hydroxy-2-oxo-4-(4-phenylanilino)-1,8-naphthyridine-3-carboxamide |
|---|---|
| PubChem CID | 86294241 |
| Molecular Formula | C28H20F2N4O3 |
| Molecular Weight | 498.49 g/mol |
| Exact Mass | 498.15 |
| IUPAC Name | N-[(2,4-difluorophenyl)methyl]-1-hydroxy-2-oxo-4-(4-phenylanilino)-1,8-naphthyridine-3-carboxamide |
| SMILES | O=C(NCc1ccc(F)cc1F)c1c(Nc2ccc(-c3ccccc3)cc2)c2cccnc2n(O)c1=O |
| InChI | InChI=1S/C28H20F2N4O3/c29-20-11-8-19(23(30)15-20)16-32-27(35)24-25(22-7-4-14-31-26(22)34(37)28(24)36)33-21-12-9-18(10-13-21)17-5-2-1-3-6-17/h1-15,33,37H,16H2,(H,32,35) |
| InChIKey | AWYQUOUGSSXBJY-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.49 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|