About 2-(4-fluorophenyl)-3,4-dihydroxy-2H-furan-5-one
2-(4-fluorophenyl)-3,4-dihydroxy-2H-furan-5-one (PubChem CID 86296038) has the molecular formula C10H7FO4
and a molecular weight of 210.16 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-3,4-dihydroxy-2H-furan-5-one.
Molecular Properties
| Compound Name | 2-(4-fluorophenyl)-3,4-dihydroxy-2H-furan-5-one |
| PubChem CID | 86296038 |
| Molecular Formula | C10H7FO4 |
| Molecular Weight | 210.16 g/mol |
| Exact Mass | 210.03 |
| IUPAC Name | 2-(4-fluorophenyl)-3,4-dihydroxy-2H-furan-5-one |
| SMILES | O=C1OC(c2ccc(F)cc2)C(O)=C1O |
| InChI | InChI=1S/C10H7FO4/c11-6-3-1-5(2-4-6)9-7(12)8(13)10(14)15-9/h1-4,9,12-13H |
| InChIKey | GGERCWXXNAPKMN-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.16 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(4-fluorophenyl)-3,4-dihydroxy-2H-furan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-fluorophenyl)-3,4-dihydroxy-2H-furan-5-one?
The IUPAC name of 2-(4-fluorophenyl)-3,4-dihydroxy-2H-furan-5-one (CID 86296038) is 2-(4-fluorophenyl)-3,4-dihydroxy-2H-furan-5-one.
What is the SMILES notation for 2-(4-fluorophenyl)-3,4-dihydroxy-2H-furan-5-one?
The canonical SMILES for 2-(4-fluorophenyl)-3,4-dihydroxy-2H-furan-5-one is O=C1OC(c2ccc(F)cc2)C(O)=C1O.
What is the InChIKey of 2-(4-fluorophenyl)-3,4-dihydroxy-2H-furan-5-one?
The InChIKey is GGERCWXXNAPKMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7FO4/c11-6-3-1-5(2-4-6)9-7(12)8(13)10(14)15-9/h1-4,9,12-13H.
What are the key properties of 2-(4-fluorophenyl)-3,4-dihydroxy-2H-furan-5-one?
2-(4-fluorophenyl)-3,4-dihydroxy-2H-furan-5-one has a molecular weight of 210.16 g/mol, XLogP of 1.75, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-fluorophenyl)-3,4-dihydroxy-2H-furan-5-one is sourced from PubChem (CID 86296038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).