About O-(4-fluorophenyl) N-[4-(aminomethyl)phenyl]-N-(4-fluorophenoxy)carbothioylcarbamothioate
O-(4-fluorophenyl) N-[4-(aminomethyl)phenyl]-N-(4-fluorophenoxy)carbothioylcarbamothioate (PubChem CID 86296237) has the molecular formula C21H16F2N2O2S2
and a molecular weight of 430.50 g/mol. Its IUPAC name is O-(4-fluorophenyl) N-[4-(aminomethyl)phenyl]-N-(4-fluorophenoxy)carbothioylcarbamothioate.
Molecular Properties
| Compound Name | O-(4-fluorophenyl) N-[4-(aminomethyl)phenyl]-N-(4-fluorophenoxy)carbothioylcarbamothioate |
| PubChem CID | 86296237 |
| Molecular Formula | C21H16F2N2O2S2 |
| Molecular Weight | 430.50 g/mol |
| Exact Mass | 430.06 |
| IUPAC Name | O-(4-fluorophenyl) N-[4-(aminomethyl)phenyl]-N-(4-fluorophenoxy)carbothioylcarbamothioate |
| SMILES | NCc1ccc(N(C(=S)Oc2ccc(F)cc2)C(=S)Oc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C21H16F2N2O2S2/c22-15-3-9-18(10-4-15)26-20(28)25(17-7-1-14(13-24)2-8-17)21(29)27-19-11-5-16(23)6-12-19/h1-12H,13,24H2 |
| InChIKey | VQWUERUCFOEWAL-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 430.50 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-(4-fluorophenyl) N-[4-(aminomethyl)phenyl]-N-(4-fluorophenoxy)carbothioylcarbamothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-(4-fluorophenyl) N-[4-(aminomethyl)phenyl]-N-(4-fluorophenoxy)carbothioylcarbamothioate?
The IUPAC name of O-(4-fluorophenyl) N-[4-(aminomethyl)phenyl]-N-(4-fluorophenoxy)carbothioylcarbamothioate (CID 86296237) is O-(4-fluorophenyl) N-[4-(aminomethyl)phenyl]-N-(4-fluorophenoxy)carbothioylcarbamothioate.
What is the SMILES notation for O-(4-fluorophenyl) N-[4-(aminomethyl)phenyl]-N-(4-fluorophenoxy)carbothioylcarbamothioate?
The canonical SMILES for O-(4-fluorophenyl) N-[4-(aminomethyl)phenyl]-N-(4-fluorophenoxy)carbothioylcarbamothioate is NCc1ccc(N(C(=S)Oc2ccc(F)cc2)C(=S)Oc2ccc(F)cc2)cc1.
What is the InChIKey of O-(4-fluorophenyl) N-[4-(aminomethyl)phenyl]-N-(4-fluorophenoxy)carbothioylcarbamothioate?
The InChIKey is VQWUERUCFOEWAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H16F2N2O2S2/c22-15-3-9-18(10-4-15)26-20(28)25(17-7-1-14(13-24)2-8-17)21(29)27-19-11-5-16(23)6-12-19/h1-12H,13,24H2.
What are the key properties of O-(4-fluorophenyl) N-[4-(aminomethyl)phenyl]-N-(4-fluorophenoxy)carbothioylcarbamothioate?
O-(4-fluorophenyl) N-[4-(aminomethyl)phenyl]-N-(4-fluorophenoxy)carbothioylcarbamothioate has a molecular weight of 430.50 g/mol, XLogP of 4.96, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for O-(4-fluorophenyl) N-[4-(aminomethyl)phenyl]-N-(4-fluorophenoxy)carbothioylcarbamothioate is sourced from PubChem (CID 86296237), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).