C19H27ClN4O7S — CID 86296398
2-[[(3aR,4S,6R,6aS)-6-[(6-chloro-5-nitro-2-propylsulfanylpyrimidin-4-yl)amino]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]oxy]ethyl acetate (PubChem CID 86296398) has the molecular formula C19H27ClN4O7S and a molecular weight of 490.97 g/mol. Its IUPAC name is 2-[[(3aR,4S,6R,6aS)-6-[(6-chloro-5-nitro-2-propylsulfanylpyrimidin-4-yl)amino]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]oxy]ethyl acetate.
| Compound Name | 2-[[(3aR,4S,6R,6aS)-6-[(6-chloro-5-nitro-2-propylsulfanylpyrimidin-4-yl)amino]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]oxy]ethyl acetate |
|---|---|
| PubChem CID | 86296398 |
| Molecular Formula | C19H27ClN4O7S |
| Molecular Weight | 490.97 g/mol |
| Exact Mass | 490.13 |
| IUPAC Name | 2-[[(3aR,4S,6R,6aS)-6-[(6-chloro-5-nitro-2-propylsulfanylpyrimidin-4-yl)amino]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]oxy]ethyl acetate |
| SMILES | CCCSc1nc(Cl)c([N+](=O)[O-])c(N[C@@H]2C[C@H](OCCOC(C)=O)[C@H]3OC(C)(C)O[C@H]32)n1 |
| InChI | InChI=1S/C19H27ClN4O7S/c1-5-8-32-18-22-16(20)13(24(26)27)17(23-18)21-11-9-12(29-7-6-28-10(2)25)15-14(11)30-19(3,4)31-15/h11-12,14-15H,5-9H2,1-4H3,(H,21,22,23)/t11-,12+,14+,15-/m1/s1 |
| InChIKey | NOFCKIRGFQJWSB-PAPYEOQZSA-N |
| XLogP | 3.19 |
| TPSA | 134.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.97 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|