C22H22F3N7O2 — CID 86296632
1-[3-[(3aR,6aS)-2-[2-(trifluoromethyl)phenyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]-[1,2,4]triazolo[4,3-a]pyridin-6-yl]-3-methylurea (PubChem CID 86296632) has the molecular formula C22H22F3N7O2 and a molecular weight of 473.46 g/mol. Its IUPAC name is 1-[3-[(3aR,6aS)-2-[2-(trifluoromethyl)phenyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]-[1,2,4]triazolo[4,3-a]pyridin-6-yl]-3-methylurea.
| Compound Name | 1-[3-[(3aR,6aS)-2-[2-(trifluoromethyl)phenyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]-[1,2,4]triazolo[4,3-a]pyridin-6-yl]-3-methylurea |
|---|---|
| PubChem CID | 86296632 |
| Molecular Formula | C22H22F3N7O2 |
| Molecular Weight | 473.46 g/mol |
| Exact Mass | 473.18 |
| IUPAC Name | 1-[3-[(3aR,6aS)-2-[2-(trifluoromethyl)phenyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]-[1,2,4]triazolo[4,3-a]pyridin-6-yl]-3-methylurea |
| SMILES | CNC(=O)Nc1ccc2nnc(C(=O)N3C[C@@H]4CN(c5ccccc5C(F)(F)F)C[C@@H]4C3)n2c1 |
| InChI | InChI=1S/C22H22F3N7O2/c1-26-21(34)27-15-6-7-18-28-29-19(32(18)12-15)20(33)31-10-13-8-30(9-14(13)11-31)17-5-3-2-4-16(17)22(23,24)25/h2-7,12-14H,8-11H2,1H3,(H2,26,27,34)/t13-,14+ |
| InChIKey | AOFKXYKATQNPOA-OKILXGFUSA-N |
| XLogP | 2.71 |
| TPSA | 94.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.46 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |