C23H20Cl2N6O — CID 86296814
6-(2,6-dichlorophenyl)-2-(4-piperazin-1-ylanilino)pyrido[4,3-d]pyrimidin-5-one (PubChem CID 86296814) has the molecular formula C23H20Cl2N6O and a molecular weight of 467.36 g/mol. Its IUPAC name is 6-(2,6-dichlorophenyl)-2-(4-piperazin-1-ylanilino)pyrido[4,3-d]pyrimidin-5-one.
| Compound Name | 6-(2,6-dichlorophenyl)-2-(4-piperazin-1-ylanilino)pyrido[4,3-d]pyrimidin-5-one |
|---|---|
| PubChem CID | 86296814 |
| Molecular Formula | C23H20Cl2N6O |
| Molecular Weight | 467.36 g/mol |
| Exact Mass | 466.11 |
| IUPAC Name | 6-(2,6-dichlorophenyl)-2-(4-piperazin-1-ylanilino)pyrido[4,3-d]pyrimidin-5-one |
| SMILES | O=c1c2cnc(Nc3ccc(N4CCNCC4)cc3)nc2ccn1-c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C23H20Cl2N6O/c24-18-2-1-3-19(25)21(18)31-11-8-20-17(22(31)32)14-27-23(29-20)28-15-4-6-16(7-5-15)30-12-9-26-10-13-30/h1-8,11,14,26H,9-10,12-13H2,(H,27,28,29) |
| InChIKey | TZPVRUSDDZQICJ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 75.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.36 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|