C24H22Cl2N6O — CID 86297009
6-(2,6-dichlorophenyl)-8-methyl-2-(4-piperazin-1-ylanilino)pyrido[4,3-d]pyrimidin-5-one (PubChem CID 86297009) has the molecular formula C24H22Cl2N6O and a molecular weight of 481.39 g/mol. Its IUPAC name is 6-(2,6-dichlorophenyl)-8-methyl-2-(4-piperazin-1-ylanilino)pyrido[4,3-d]pyrimidin-5-one.
| Compound Name | 6-(2,6-dichlorophenyl)-8-methyl-2-(4-piperazin-1-ylanilino)pyrido[4,3-d]pyrimidin-5-one |
|---|---|
| PubChem CID | 86297009 |
| Molecular Formula | C24H22Cl2N6O |
| Molecular Weight | 481.39 g/mol |
| Exact Mass | 480.12 |
| IUPAC Name | 6-(2,6-dichlorophenyl)-8-methyl-2-(4-piperazin-1-ylanilino)pyrido[4,3-d]pyrimidin-5-one |
| SMILES | Cc1cn(-c2c(Cl)cccc2Cl)c(=O)c2cnc(Nc3ccc(N4CCNCC4)cc3)nc12 |
| InChI | InChI=1S/C24H22Cl2N6O/c1-15-14-32(22-19(25)3-2-4-20(22)26)23(33)18-13-28-24(30-21(15)18)29-16-5-7-17(8-6-16)31-11-9-27-10-12-31/h2-8,13-14,27H,9-12H2,1H3,(H,28,29,30) |
| InChIKey | WAERUNJWVBAXMQ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 75.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.39 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|