C23H19Cl2N5O3S — CID 86297202
6-(2,6-dichlorophenyl)-2-[4-(1,1-dioxo-1,4-thiazinan-4-yl)anilino]pyrido[4,3-d]pyrimidin-5-one (PubChem CID 86297202) has the molecular formula C23H19Cl2N5O3S and a molecular weight of 516.41 g/mol. Its IUPAC name is 6-(2,6-dichlorophenyl)-2-[4-(1,1-dioxo-1,4-thiazinan-4-yl)anilino]pyrido[4,3-d]pyrimidin-5-one.
| Compound Name | 6-(2,6-dichlorophenyl)-2-[4-(1,1-dioxo-1,4-thiazinan-4-yl)anilino]pyrido[4,3-d]pyrimidin-5-one |
|---|---|
| PubChem CID | 86297202 |
| Molecular Formula | C23H19Cl2N5O3S |
| Molecular Weight | 516.41 g/mol |
| Exact Mass | 515.06 |
| IUPAC Name | 6-(2,6-dichlorophenyl)-2-[4-(1,1-dioxo-1,4-thiazinan-4-yl)anilino]pyrido[4,3-d]pyrimidin-5-one |
| SMILES | O=c1c2cnc(Nc3ccc(N4CCS(=O)(=O)CC4)cc3)nc2ccn1-c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C23H19Cl2N5O3S/c24-18-2-1-3-19(25)21(18)30-9-8-20-17(22(30)31)14-26-23(28-20)27-15-4-6-16(7-5-15)29-10-12-34(32,33)13-11-29/h1-9,14H,10-13H2,(H,26,27,28) |
| InChIKey | QGRUBCQWGRBRBF-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.41 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|