C19H22F3N5S2 — CID 86297265
4-[5-(5,5-dimethyl-4H-1,3-thiazol-2-yl)-2,5-diazabicyclo[2.2.2]octan-2-yl]-6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidine (PubChem CID 86297265) has the molecular formula C19H22F3N5S2 and a molecular weight of 441.55 g/mol. Its IUPAC name is 4-[5-(5,5-dimethyl-4H-1,3-thiazol-2-yl)-2,5-diazabicyclo[2.2.2]octan-2-yl]-6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidine.
| Compound Name | 4-[5-(5,5-dimethyl-4H-1,3-thiazol-2-yl)-2,5-diazabicyclo[2.2.2]octan-2-yl]-6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 86297265 |
| Molecular Formula | C19H22F3N5S2 |
| Molecular Weight | 441.55 g/mol |
| Exact Mass | 441.13 |
| IUPAC Name | 4-[5-(5,5-dimethyl-4H-1,3-thiazol-2-yl)-2,5-diazabicyclo[2.2.2]octan-2-yl]-6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidine |
| SMILES | CC1(C)CN=C(N2CC3CCC2CN3c2ncnc3sc(CC(F)(F)F)cc23)S1 |
| InChI | InChI=1S/C19H22F3N5S2/c1-18(2)9-23-17(29-18)27-8-11-3-4-12(27)7-26(11)15-14-5-13(6-19(20,21)22)28-16(14)25-10-24-15/h5,10-12H,3-4,6-9H2,1-2H3 |
| InChIKey | UCMQDJGSXJEGJS-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 44.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.55 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |