C18H20ClFN4O2 — CID 86297371
(2S,6S)-10-(2-chloro-4-fluorophenyl)-4-(oxan-4-yl)-7-oxa-1,4,11,12-tetrazatricyclo[7.3.0.02,6]dodeca-9,11-diene (PubChem CID 86297371) has the molecular formula C18H20ClFN4O2 and a molecular weight of 378.84 g/mol. Its IUPAC name is (2S,6S)-10-(2-chloro-4-fluorophenyl)-4-(oxan-4-yl)-7-oxa-1,4,11,12-tetrazatricyclo[7.3.0.02,6]dodeca-9,11-diene.
| Compound Name | (2S,6S)-10-(2-chloro-4-fluorophenyl)-4-(oxan-4-yl)-7-oxa-1,4,11,12-tetrazatricyclo[7.3.0.02,6]dodeca-9,11-diene |
|---|---|
| PubChem CID | 86297371 |
| Molecular Formula | C18H20ClFN4O2 |
| Molecular Weight | 378.84 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | (2S,6S)-10-(2-chloro-4-fluorophenyl)-4-(oxan-4-yl)-7-oxa-1,4,11,12-tetrazatricyclo[7.3.0.02,6]dodeca-9,11-diene |
| SMILES | Fc1ccc(-c2nnn3c2CO[C@H]2CN(C4CCOCC4)C[C@@H]23)c(Cl)c1 |
| InChI | InChI=1S/C18H20ClFN4O2/c19-14-7-11(20)1-2-13(14)18-16-10-26-17-9-23(12-3-5-25-6-4-12)8-15(17)24(16)22-21-18/h1-2,7,12,15,17H,3-6,8-10H2/t15-,17-/m0/s1 |
| InChIKey | CBGSTZUHDQZOBG-RDJZCZTQSA-N |
| XLogP | 2.67 |
| TPSA | 52.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.84 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |