C24H22Cl2N6O — CID 86297397
6-(2,6-dichlorophenyl)-2-[4-(4-methylpiperazin-1-yl)anilino]pyrido[4,3-d]pyrimidin-5-one (PubChem CID 86297397) has the molecular formula C24H22Cl2N6O and a molecular weight of 481.39 g/mol. Its IUPAC name is 6-(2,6-dichlorophenyl)-2-[4-(4-methylpiperazin-1-yl)anilino]pyrido[4,3-d]pyrimidin-5-one.
| Compound Name | 6-(2,6-dichlorophenyl)-2-[4-(4-methylpiperazin-1-yl)anilino]pyrido[4,3-d]pyrimidin-5-one |
|---|---|
| PubChem CID | 86297397 |
| Molecular Formula | C24H22Cl2N6O |
| Molecular Weight | 481.39 g/mol |
| Exact Mass | 480.12 |
| IUPAC Name | 6-(2,6-dichlorophenyl)-2-[4-(4-methylpiperazin-1-yl)anilino]pyrido[4,3-d]pyrimidin-5-one |
| SMILES | CN1CCN(c2ccc(Nc3ncc4c(=O)n(-c5c(Cl)cccc5Cl)ccc4n3)cc2)CC1 |
| InChI | InChI=1S/C24H22Cl2N6O/c1-30-11-13-31(14-12-30)17-7-5-16(6-8-17)28-24-27-15-18-21(29-24)9-10-32(23(18)33)22-19(25)3-2-4-20(22)26/h2-10,15H,11-14H2,1H3,(H,27,28,29) |
| InChIKey | MDIKVAKEOQZBRR-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.39 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|