C22H22F3N3O5S — CID 86297417
2-[[(3aR,6aS)-2-[2-(trifluoromethyl)phenyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]amino]-5-methylsulfonylbenzoic acid (PubChem CID 86297417) has the molecular formula C22H22F3N3O5S and a molecular weight of 497.50 g/mol. Its IUPAC name is 2-[[(3aR,6aS)-2-[2-(trifluoromethyl)phenyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]amino]-5-methylsulfonylbenzoic acid.
| Compound Name | 2-[[(3aR,6aS)-2-[2-(trifluoromethyl)phenyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]amino]-5-methylsulfonylbenzoic acid |
|---|---|
| PubChem CID | 86297417 |
| Molecular Formula | C22H22F3N3O5S |
| Molecular Weight | 497.50 g/mol |
| Exact Mass | 497.12 |
| IUPAC Name | 2-[[(3aR,6aS)-2-[2-(trifluoromethyl)phenyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]amino]-5-methylsulfonylbenzoic acid |
| SMILES | CS(=O)(=O)c1ccc(NC(=O)N2C[C@@H]3CN(c4ccccc4C(F)(F)F)C[C@@H]3C2)c(C(=O)O)c1 |
| InChI | InChI=1S/C22H22F3N3O5S/c1-34(32,33)15-6-7-18(16(8-15)20(29)30)26-21(31)28-11-13-9-27(10-14(13)12-28)19-5-3-2-4-17(19)22(23,24)25/h2-8,13-14H,9-12H2,1H3,(H,26,31)(H,29,30)/t13-,14+ |
| InChIKey | WNUSKFCBFNFJND-OKILXGFUSA-N |
| XLogP | 3.41 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.50 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |