C27H25N3O5S — CID 86297481
N-[4-[4-hydroxy-4-(2-hydroxyphenyl)piperidine-1-carbonyl]phenyl]quinoline-8-sulfonamide (PubChem CID 86297481) has the molecular formula C27H25N3O5S and a molecular weight of 503.58 g/mol. Its IUPAC name is N-[4-[4-hydroxy-4-(2-hydroxyphenyl)piperidine-1-carbonyl]phenyl]quinoline-8-sulfonamide.
| Compound Name | N-[4-[4-hydroxy-4-(2-hydroxyphenyl)piperidine-1-carbonyl]phenyl]quinoline-8-sulfonamide |
|---|---|
| PubChem CID | 86297481 |
| Molecular Formula | C27H25N3O5S |
| Molecular Weight | 503.58 g/mol |
| Exact Mass | 503.15 |
| IUPAC Name | N-[4-[4-hydroxy-4-(2-hydroxyphenyl)piperidine-1-carbonyl]phenyl]quinoline-8-sulfonamide |
| SMILES | O=C(c1ccc(NS(=O)(=O)c2cccc3cccnc23)cc1)N1CCC(O)(c2ccccc2O)CC1 |
| InChI | InChI=1S/C27H25N3O5S/c31-23-8-2-1-7-22(23)27(33)14-17-30(18-15-27)26(32)20-10-12-21(13-11-20)29-36(34,35)24-9-3-5-19-6-4-16-28-25(19)24/h1-13,16,29,31,33H,14-15,17-18H2 |
| InChIKey | WBGPBQNWWGXBIB-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 119.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.58 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |