C19H18FN5O — CID 86297989
(2R,6R)-10-(2-fluorophenyl)-4-(pyridin-3-ylmethyl)-7-oxa-1,4,11,12-tetrazatricyclo[7.3.0.02,6]dodeca-9,11-diene (PubChem CID 86297989) has the molecular formula C19H18FN5O and a molecular weight of 351.38 g/mol. Its IUPAC name is (2R,6R)-10-(2-fluorophenyl)-4-(pyridin-3-ylmethyl)-7-oxa-1,4,11,12-tetrazatricyclo[7.3.0.02,6]dodeca-9,11-diene.
| Compound Name | (2R,6R)-10-(2-fluorophenyl)-4-(pyridin-3-ylmethyl)-7-oxa-1,4,11,12-tetrazatricyclo[7.3.0.02,6]dodeca-9,11-diene |
|---|---|
| PubChem CID | 86297989 |
| Molecular Formula | C19H18FN5O |
| Molecular Weight | 351.38 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | (2R,6R)-10-(2-fluorophenyl)-4-(pyridin-3-ylmethyl)-7-oxa-1,4,11,12-tetrazatricyclo[7.3.0.02,6]dodeca-9,11-diene |
| SMILES | Fc1ccccc1-c1nnn2c1CO[C@@H]1CN(Cc3cccnc3)C[C@H]12 |
| InChI | InChI=1S/C19H18FN5O/c20-15-6-2-1-5-14(15)19-17-12-26-18-11-24(9-13-4-3-7-21-8-13)10-16(18)25(17)23-22-19/h1-8,16,18H,9-12H2/t16-,18-/m1/s1 |
| InChIKey | HYSGNQCRZJJWHT-SJLPKXTDSA-N |
| XLogP | 2.43 |
| TPSA | 56.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.38 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |