C16H25N9O — CID 86298201
1-[4,8-bis(methylamino)-6-(2-propylhydrazinyl)pyrimido[5,4-d]pyrimidin-2-yl]piperidin-4-one (PubChem CID 86298201) has the molecular formula C16H25N9O and a molecular weight of 359.44 g/mol. Its IUPAC name is 1-[4,8-bis(methylamino)-6-(2-propylhydrazinyl)pyrimido[5,4-d]pyrimidin-2-yl]piperidin-4-one.
| Compound Name | 1-[4,8-bis(methylamino)-6-(2-propylhydrazinyl)pyrimido[5,4-d]pyrimidin-2-yl]piperidin-4-one |
|---|---|
| PubChem CID | 86298201 |
| Molecular Formula | C16H25N9O |
| Molecular Weight | 359.44 g/mol |
| Exact Mass | 359.22 |
| IUPAC Name | 1-[4,8-bis(methylamino)-6-(2-propylhydrazinyl)pyrimido[5,4-d]pyrimidin-2-yl]piperidin-4-one |
| SMILES | CCCNNc1nc(NC)c2nc(N3CCC(=O)CC3)nc(NC)c2n1 |
| InChI | InChI=1S/C16H25N9O/c1-4-7-19-24-15-20-11-12(13(17-2)22-15)21-16(23-14(11)18-3)25-8-5-10(26)6-9-25/h19H,4-9H2,1-3H3,(H,18,21,23)(H2,17,20,22,24) |
| InChIKey | OXAURISHUYUMEN-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 119.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.44 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|