C9H8Cl2N4O2S — CID 86298261
N-(3,5-dichlorophenyl)-5-methylsulfonyl-1H-1,2,4-triazol-3-amine (PubChem CID 86298261) has the molecular formula C9H8Cl2N4O2S and a molecular weight of 307.16 g/mol. Its IUPAC name is N-(3,5-dichlorophenyl)-5-methylsulfonyl-1H-1,2,4-triazol-3-amine.
| Compound Name | N-(3,5-dichlorophenyl)-5-methylsulfonyl-1H-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 86298261 |
| Molecular Formula | C9H8Cl2N4O2S |
| Molecular Weight | 307.16 g/mol |
| Exact Mass | 305.97 |
| IUPAC Name | N-(3,5-dichlorophenyl)-5-methylsulfonyl-1H-1,2,4-triazol-3-amine |
| SMILES | CS(=O)(=O)c1nc(Nc2cc(Cl)cc(Cl)c2)n[nH]1 |
| InChI | InChI=1S/C9H8Cl2N4O2S/c1-18(16,17)9-13-8(14-15-9)12-7-3-5(10)2-6(11)4-7/h2-4H,1H3,(H2,12,13,14,15) |
| InChIKey | HRWWOLQTLKHIMS-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.16 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |