About hexyl pyrazine-2-carboxylate
hexyl pyrazine-2-carboxylate (PubChem CID 86298568) has the molecular formula C11H16N2O2
and a molecular weight of 208.26 g/mol. Its IUPAC name is hexyl pyrazine-2-carboxylate.
Molecular Properties
| Compound Name | hexyl pyrazine-2-carboxylate |
| PubChem CID | 86298568 |
| Molecular Formula | C11H16N2O2 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.12 |
| IUPAC Name | hexyl pyrazine-2-carboxylate |
| SMILES | CCCCCCOC(=O)c1cnccn1 |
| InChI | InChI=1S/C11H16N2O2/c1-2-3-4-5-8-15-11(14)10-9-12-6-7-13-10/h6-7,9H,2-5,8H2,1H3 |
| InChIKey | MJWXQAHAWJNGBW-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze hexyl pyrazine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexyl pyrazine-2-carboxylate?
The IUPAC name of hexyl pyrazine-2-carboxylate (CID 86298568) is hexyl pyrazine-2-carboxylate.
What is the SMILES notation for hexyl pyrazine-2-carboxylate?
The canonical SMILES for hexyl pyrazine-2-carboxylate is CCCCCCOC(=O)c1cnccn1.
What is the InChIKey of hexyl pyrazine-2-carboxylate?
The InChIKey is MJWXQAHAWJNGBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2O2/c1-2-3-4-5-8-15-11(14)10-9-12-6-7-13-10/h6-7,9H,2-5,8H2,1H3.
What are the key properties of hexyl pyrazine-2-carboxylate?
hexyl pyrazine-2-carboxylate has a molecular weight of 208.26 g/mol, XLogP of 2.21, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for hexyl pyrazine-2-carboxylate is sourced from PubChem (CID 86298568), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).