C17H22N4O3 — CID 86298864
9-methyl-3,10-dioxa-7,16,18,22-tetrazatricyclo[15.3.1.12,5]docosa-1(21),2(22),4,17,19-pentaen-6-one (PubChem CID 86298864) has the molecular formula C17H22N4O3 and a molecular weight of 330.39 g/mol. Its IUPAC name is 9-methyl-3,10-dioxa-7,16,18,22-tetrazatricyclo[15.3.1.12,5]docosa-1(21),2(22),4,17,19-pentaen-6-one.
| Compound Name | 9-methyl-3,10-dioxa-7,16,18,22-tetrazatricyclo[15.3.1.12,5]docosa-1(21),2(22),4,17,19-pentaen-6-one |
|---|---|
| PubChem CID | 86298864 |
| Molecular Formula | C17H22N4O3 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | 9-methyl-3,10-dioxa-7,16,18,22-tetrazatricyclo[15.3.1.12,5]docosa-1(21),2(22),4,17,19-pentaen-6-one |
| SMILES | CC1CNC(=O)c2coc(n2)-c2ccnc(c2)NCCCCCO1 |
| InChI | InChI=1S/C17H22N4O3/c1-12-10-20-16(22)14-11-24-17(21-14)13-5-7-19-15(9-13)18-6-3-2-4-8-23-12/h5,7,9,11-12H,2-4,6,8,10H2,1H3,(H,18,19)(H,20,22) |
| InChIKey | MGFTXGGIVNLRHO-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 89.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |