C16H10F3N5O — CID 86298900
7-pyridin-3-yl-5-(2,2,2-trifluoroethyl)-1H-pyrazolo[4,5-c][1,5]naphthyridin-4-one (PubChem CID 86298900) has the molecular formula C16H10F3N5O and a molecular weight of 345.28 g/mol. Its IUPAC name is 7-pyridin-3-yl-5-(2,2,2-trifluoroethyl)-1H-pyrazolo[4,5-c][1,5]naphthyridin-4-one.
| Compound Name | 7-pyridin-3-yl-5-(2,2,2-trifluoroethyl)-1H-pyrazolo[4,5-c][1,5]naphthyridin-4-one |
|---|---|
| PubChem CID | 86298900 |
| Molecular Formula | C16H10F3N5O |
| Molecular Weight | 345.28 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | 7-pyridin-3-yl-5-(2,2,2-trifluoroethyl)-1H-pyrazolo[4,5-c][1,5]naphthyridin-4-one |
| SMILES | O=c1c2cn[nH]c2c2ncc(-c3cccnc3)cc2n1CC(F)(F)F |
| InChI | InChI=1S/C16H10F3N5O/c17-16(18,19)8-24-12-4-10(9-2-1-3-20-5-9)6-21-14(12)13-11(15(24)25)7-22-23-13/h1-7H,8H2,(H,22,23) |
| InChIKey | GQZKTDKWPYTAJL-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.28 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|