C23H27N4O8P — CID 86299046
4-(dimethylamino)butyl 5-[3-[(2-formyl-3-phosphonooxyphenoxy)methyl]-2-pyridinyl]pyrazole-1-carboxylate (PubChem CID 86299046) has the molecular formula C23H27N4O8P and a molecular weight of 518.46 g/mol. Its IUPAC name is 4-(dimethylamino)butyl 5-[3-[(2-formyl-3-phosphonooxyphenoxy)methyl]-2-pyridinyl]pyrazole-1-carboxylate.
| Compound Name | 4-(dimethylamino)butyl 5-[3-[(2-formyl-3-phosphonooxyphenoxy)methyl]-2-pyridinyl]pyrazole-1-carboxylate |
|---|---|
| PubChem CID | 86299046 |
| Molecular Formula | C23H27N4O8P |
| Molecular Weight | 518.46 g/mol |
| Exact Mass | 518.16 |
| IUPAC Name | 4-(dimethylamino)butyl 5-[3-[(2-formyl-3-phosphonooxyphenoxy)methyl]-2-pyridinyl]pyrazole-1-carboxylate |
| SMILES | CN(C)CCCCOC(=O)n1nccc1-c1ncccc1COc1cccc(OP(=O)(O)O)c1C=O |
| InChI | InChI=1S/C23H27N4O8P/c1-26(2)13-3-4-14-33-23(29)27-19(10-12-25-27)22-17(7-6-11-24-22)16-34-20-8-5-9-21(18(20)15-28)35-36(30,31)32/h5-12,15H,3-4,13-14,16H2,1-2H3,(H2,30,31,32) |
| InChIKey | TWZASGNXAHOAEZ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 153.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.46 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|