C19H20N6O4S — CID 86299071
10-methyl-18,21-dioxa-3-thia-7,10,11,14,23,27-hexazatetracyclo[20.3.1.12,5.08,12]heptacosa-1(26),2(27),4,8,11,22,24-heptaene-6,13-dione (PubChem CID 86299071) has the molecular formula C19H20N6O4S and a molecular weight of 428.47 g/mol. Its IUPAC name is 10-methyl-18,21-dioxa-3-thia-7,10,11,14,23,27-hexazatetracyclo[20.3.1.12,5.08,12]heptacosa-1(26),2(27),4,8,11,22,24-heptaene-6,13-dione.
| Compound Name | 10-methyl-18,21-dioxa-3-thia-7,10,11,14,23,27-hexazatetracyclo[20.3.1.12,5.08,12]heptacosa-1(26),2(27),4,8,11,22,24-heptaene-6,13-dione |
|---|---|
| PubChem CID | 86299071 |
| Molecular Formula | C19H20N6O4S |
| Molecular Weight | 428.47 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | 10-methyl-18,21-dioxa-3-thia-7,10,11,14,23,27-hexazatetracyclo[20.3.1.12,5.08,12]heptacosa-1(26),2(27),4,8,11,22,24-heptaene-6,13-dione |
| SMILES | Cn1cc2c(n1)C(=O)NCCCOCCOc1cc(ccn1)-c1nc(cs1)C(=O)N2 |
| InChI | InChI=1S/C19H20N6O4S/c1-25-10-13-16(24-25)18(27)21-4-2-6-28-7-8-29-15-9-12(3-5-20-15)19-23-14(11-30-19)17(26)22-13/h3,5,9-11H,2,4,6-8H2,1H3,(H,21,27)(H,22,26) |
| InChIKey | NMSZYUWMQGDGBS-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 120.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.47 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |