C16H18N4O4S — CID 86299073
14,17-dioxa-3-thia-7,11,19,23-tetrazatricyclo[16.3.1.12,5]tricosa-1(22),2(23),4,18,20-pentaene-6,10-dione (PubChem CID 86299073) has the molecular formula C16H18N4O4S and a molecular weight of 362.41 g/mol. Its IUPAC name is 14,17-dioxa-3-thia-7,11,19,23-tetrazatricyclo[16.3.1.12,5]tricosa-1(22),2(23),4,18,20-pentaene-6,10-dione.
| Compound Name | 14,17-dioxa-3-thia-7,11,19,23-tetrazatricyclo[16.3.1.12,5]tricosa-1(22),2(23),4,18,20-pentaene-6,10-dione |
|---|---|
| PubChem CID | 86299073 |
| Molecular Formula | C16H18N4O4S |
| Molecular Weight | 362.41 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | 14,17-dioxa-3-thia-7,11,19,23-tetrazatricyclo[16.3.1.12,5]tricosa-1(22),2(23),4,18,20-pentaene-6,10-dione |
| SMILES | O=C1CCNC(=O)c2csc(n2)-c2ccnc(c2)OCCOCCN1 |
| InChI | InChI=1S/C16H18N4O4S/c21-13-2-4-19-15(22)12-10-25-16(20-12)11-1-3-18-14(9-11)24-8-7-23-6-5-17-13/h1,3,9-10H,2,4-8H2,(H,17,21)(H,19,22) |
| InChIKey | NRDCKRHEWVUHKA-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 102.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.41 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |